| HWiNFO64 v6.40-4330 |
| Creation Time | 09.12.2020 12:07 |
|
Content: |
| DESKTOP-MGR8MPK |
| [Current Computer] | ||
| Computer Name: | DESKTOP-MGR8MPK | |
| Computer Brand Name: | LENOVO Lenovo ideapad 300-14ISK | |
| [Operating System] | ||
| Operating System: | Microsoft Windows 10 Professional (x64) Build 19042.631 (20H2) | |
| UEFI Boot: | Present | |
| Secure Boot: | Not Present | |
| Central Processor(s) |
| [CPU Unit Count] | ||
| Number Of Processor Packages (Physical): | 1 | |
| Number Of Processor Cores: | 2 | |
| Number Of Logical Processors: | 4 | |
| Intel Core i5-6200U |
| [General Information] | ||
| Processor Name: | Intel Core i5-6200U | |
| Original Processor Frequency: | 2400.0 MHz | |
| Original Processor Frequency [MHz]: | 2400 | |
| CPU ID: | 000406E3 | |
| CPU Brand Name: | Intel(R) Core(TM) i5-6200U CPU @ 2.30GHz | |
| CPU Vendor: | GenuineIntel | |
| CPU Stepping: | D0/D1 | |
| CPU Code Name: | Skylake-U | |
| CPU Technology: | 14 nm | |
| CPU S-Spec: | SR2EY | |
| CPU Thermal Design Power (TDP): | 15.0 W | |
| CPU Power Limits (Max): | Power = Unlimited, Time = Unlimited | |
| CPU Power Limit 1 - Long Duration: | (15.00 W) (28.00 sec) [Unlocked] | |
| CPU Power Limit 2 - Short Duration: | (25.00 W) (2.44 ms) [Unlocked] | |
| Configurable TDP Level 1 (Down): | 7.50 W (Unlimited range), 800 MHz | |
| Configurable TDP Level 2 (Up): | 25.00 W (Unlimited range), 2400 MHz | |
| Current Configurable TDP Level: | Nominal [Unlocked] | |
| CPU Max. Junction Temperature (Tj,max): | 100 °C | |
| CPU Type: | Production Unit | |
| CPU Platform: | BGA1356 | |
| Microcode Update Revision: | CC | |
| Number of CPU Cores: | 2 | |
| Number of Logical CPUs: | 4 | |
| [Operating Points] | ||
| CPU MFM (LowPower): | 400.0 MHz = 4 x 100.0 MHz | |
| CPU LFM (Minimum): | 400.0 MHz = 4 x 100.0 MHz | |
| CPU HFM (Base): | 2400.0 MHz = 24 x 100.0 MHz | |
| CPU Turbo Max: | 2800.0 MHz = 28 x 100.0 MHz [Unlocked] | |
| Turbo Ratio Limits: | 28x (1c), 27x (2-4c) | |
| CPU Current: | 2693.4 MHz = 27 x 99.8 MHz @ 0.9645 V | |
| LLC/Ring Maximum: | 2800.0 MHz = 28.00 x 100.0 MHz | |
| LLC/Ring Current: | 2793.2 MHz = 28.00 x 99.8 MHz | |
| System Agent Current: | 798.0 MHz = 8.00 x 99.8 MHz | |
| CPU Bus Type: | OPI | |
| [IA Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | 28x | |
| OC Ratio Limit: | N/A | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 29.00 A | |
| [GT (Slice) Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | 20x | |
| OC Ratio Limit: | N/A | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 32.00 A | |
| [CLR (CBo/LLC/Ring) Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | 28x | |
| OC Ratio Limit: | N/A | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 29.00 A | |
| [GT (Unslice) Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | 20x | |
| OC Ratio Limit: | N/A | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 32.00 A | |
| [Uncore/SA Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Not Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | N/A | |
| OC Ratio Limit: | N/A | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 5.00 A | |
| [Cache and TLB] | ||
| L1 Cache: | Instruction: 2 x 32 KBytes, Data: 2 x 32 KBytes | |
| L2 Cache: | Integrated: 2 x 256 KBytes | |
| L3 Cache: | 3 MBytes | |
| Instruction TLB: | 2MB/4MB Pages, Fully associative, 8 entries | |
| Data TLB: | 4 KB Pages, 4-way set associative, 64 entries | |
| [Standard Feature Flags] | ||
| FPU on Chip | Present | |
| Enhanced Virtual-86 Mode | Present | |
| I/O Breakpoints | Present | |
| Page Size Extensions | Present | |
| Time Stamp Counter | Present | |
| Pentium-style Model Specific Registers | Present | |
| Physical Address Extension | Present | |
| Machine Check Exception | Present | |
| CMPXCHG8B Instruction | Present | |
| APIC On Chip / PGE (AMD) | Present | |
| Fast System Call | Present | |
| Memory Type Range Registers | Present | |
| Page Global Feature | Present | |
| Machine Check Architecture | Present | |
| CMOV Instruction | Present | |
| Page Attribute Table | Present | |
| 36-bit Page Size Extensions | Present | |
| Processor Number | Not Present | |
| CLFLUSH Instruction | Present | |
| Debug Trace and EMON Store | Present | |
| Internal ACPI Support | Present | |
| MMX Technology | Present | |
| Fast FP Save/Restore (IA MMX-2) | Present | |
| Streaming SIMD Extensions | Present | |
| Streaming SIMD Extensions 2 | Present | |
| Self-Snoop | Present | |
| Multi-Threading Capable | Present | |
| Automatic Clock Control | Present | |
| IA-64 Processor | Not Present | |
| Signal Break on FERR | Present | |
| Virtual Machine Extensions (VMX) | Present | |
| Safer Mode Extensions (Intel TXT) | Not Present | |
| Streaming SIMD Extensions 3 | Present | |
| Supplemental Streaming SIMD Extensions 3 | Present | |
| Streaming SIMD Extensions 4.1 | Present | |
| Streaming SIMD Extensions 4.2 | Present | |
| AVX Support | Present | |
| Fused Multiply Add (FMA) | Present | |
| Carryless Multiplication (PCLMULQDQ)/GFMUL | Present | |
| CMPXCHG16B Support | Present | |
| MOVBE Instruction | Present | |
| POPCNT Instruction | Present | |
| XSAVE/XRSTOR/XSETBV/XGETBV Instructions | Present | |
| XGETBV/XSETBV OS Enabled | Present | |
| Float16 Instructions | Present | |
| AES Cryptography Support | Present | |
| Random Number Read Instruction (RDRAND) | Present | |
| Extended xAPIC | Present | |
| MONITOR/MWAIT Support | Present | |
| Thermal Monitor 2 | Present | |
| Enhanced SpeedStep Technology | Present | |
| L1 Context ID | Not Present | |
| Send Task Priority Messages Disabling | Present | |
| Processor Context ID | Present | |
| Direct Cache Access | Not Present | |
| TSC-deadline Timer | Present | |
| Performance/Debug Capability MSR | Present | |
| IA32 Debug Interface Support | Present | |
| 64-Bit Debug Store | Present | |
| CPL Qualified Debug Store | Present | |
| [Extended Feature Flags] | ||
| 64-bit Extensions | Present | |
| RDTSCP and TSC_AUX Support | Present | |
| 1 GB large page support | Present | |
| No Execute | Present | |
| SYSCALL/SYSRET Support | Present | |
| Bit Manipulation Instructions Set 1 | Present | |
| Bit Manipulation Instructions Set 2 | Present | |
| Advanced Vector Extensions 2 (AVX2) | Present | |
| Advanced Vector Extensions 512 (AVX-512) | Not Present | |
| AVX-512 Prefetch Instructions | Not Present | |
| AVX-512 Exponential and Reciprocal Instructions | Not Present | |
| AVX-512 Conflict Detection Instructions | Not Present | |
| AVX-512 Doubleword and Quadword Instructions | Not Present | |
| AVX-512 Byte and Word Instructions | Not Present | |
| AVX-512 Vector Length Extensions | Not Present | |
| AVX-512 52-bit Integer FMA Instructions | Not Present | |
| Secure Hash Algorithm (SHA) Extensions | Not Present | |
| Software Guard Extensions (SGX) Support | Present | |
| Supervisor Mode Execution Protection (SMEP) | Present | |
| Supervisor Mode Access Prevention (SMAP) | Present | |
| Hardware Lock Elision (HLE) | Not Present | |
| Restricted Transactional Memory (RTM) | Not Present | |
| Memory Protection Extensions (MPX) | Present | |
| Read/Write FS/GS Base Instructions | Present | |
| Enhanced Performance String Instruction | Present | |
| INVPCID Instruction | Present | |
| RDSEED Instruction | Present | |
| Multi-precision Add Carry Instructions (ADX) | Present | |
| PCOMMIT Instructions | Not Present | |
| CLFLUSHOPT Instructions | Present | |
| CLWB Instructions | Not Present | |
| TSC_THREAD_OFFSET | Present | |
| Platform Quality of Service Monitoring (PQM) | Not Present | |
| Platform Quality of Service Enforcement (PQE) | Not Present | |
| FPU Data Pointer updated only on x87 Exceptions | Not Present | |
| Deprecated FPU CS and FPU DS | Present | |
| Intel Processor Trace | Present | |
| PREFETCHWT1 Instruction | Not Present | |
| AVX-512 Vector Bit Manipulation Instructions | Not Present | |
| AVX-512 Vector Bit Manipulation Instructions 2 | Not Present | |
| AVX-512 Galois Fields New Instructions | Not Present | |
| AVX-512 Vector AES | Not Present | |
| AVX-512 Vector Neural Network Instructions | Not Present | |
| AVX-512 Bit Algorithms | Not Present | |
| AVX-512 Carry-Less Multiplication Quadword (VPCLMULQDQ) | Not Present | |
| AVX-512 Vector POPCNT (VPOPCNTD/VPOPCNTQ) | Not Present | |
| User-Mode Instruction Prevention | Not Present | |
| Protection Keys for User-mode Pages | Not Present | |
| OS Enabled Protection Keys | Not Present | |
| Wait and Pause Enhancements (WAITPKG) | Not Present | |
| Total Memory Encryption | Not Present | |
| Read Processor ID | Not Present | |
| Cache Line Demote | Not Present | |
| MOVDIRI: Direct Stores | Not Present | |
| MOVDIR64B: Direct Stores | Not Present | |
| ENQCMD: Enqueue Stores | Not Present | |
| SGX Launch Configuration | Not Present | |
| Control-Flow Enforcement Technology (CET) Shadow Stack | Not Present | |
| AVX-512 4 x Vector Neural Network Instructions Word Variable Precision | Not Present | |
| AVX-512 4 x Fused Multiply Accumulation Packed Single Precision | Not Present | |
| Fast Short REP MOV | Not Present | |
| AVX-512 VP2INTERSECT Support | Not Present | |
| MD_CLEAR Support | Present | |
| Hybrid Processor | Not Present | |
| Platform Configuration (PCONFIG) | Not Present | |
| Indirect Branch Restricted Speculation (IBRS), Indirect Branch Predictor Barrier (IBPB) | Present | |
| Single Thread Indirect Branch Predictors (STIBP) | Present | |
| L1D_FLUSH Support | Present | |
| IA32_ARCH_CAPABILITIES MSR | Not Present | |
| IA32_CORE_CAPABILITIES MSR | Not Present | |
| Speculative Store Bypass Disable (SSBD) | Present | |
| Control-Flow Enforcement Technology (CET) Indirect Branch Tracking | Not Present | |
| Advanced Matrix Extensions (AMX) Tile Architecture | Not Present | |
| Advanced Matrix Extensions (AMX) bfloat16 Support | Not Present | |
| Advanced Matrix Extensions (AMX) 8-bit Integer Operations | Not Present | |
| AVX-512 BFLOAT16 Instructions | Not Present | |
| [Enhanced Features] | ||
| Thermal Monitor 1: | Supported, Enabled | |
| Thermal Monitor 2: | Supported, Enabled | |
| Enhanced Intel SpeedStep (GV3): | Supported, Enabled | |
| Bi-directional PROCHOT#: | Enabled | |
| Extended Auto-HALT State C1E: | Enabled | |
| MLC Streamer Prefetcher | Supported, Enabled | |
| MLC Spatial Prefetcher | Supported, Enabled | |
| DCU Streamer Prefetcher | Supported, Enabled | |
| DCU IP Prefetcher | Supported, Enabled | |
| Intel Dynamic Acceleration (IDA) Technology: | Not Supported | |
| Intel Dynamic FSB Switching: | Not Supported | |
| Intel Turbo Boost Technology: | Supported, Enabled | |
| Programmable Ratio Limits: | Supported, Disabled | |
| Programmable TDC/TDP Limits: | Supported, Disabled | |
| Hardware Duty Cycling: | Supported, Enabled | |
| [CPU SKU Features] | ||
| Display HD Audio: | Supported | |
| DMI x4 Width: | Supported | |
| DRAM ECC: | Not Supported | |
| VT-d: | Supported | |
| DMI in Gen2 Mode: | Not Supported | |
| PEG in Gen2 Mode: | Not Supported | |
| 1N Mode DDR Timings: | Supported | |
| Camarillo (DTT) Device: | Supported | |
| 2 DIMMs per Channel: | Not Supported | |
| X2APIC: | Supported | |
| Dual Memory Channel: | Supported | |
| Integrated GPU (IGD): | Enabled | |
| DDR Overclocking: | Disabled | |
| Overclocking by DSKU: | Enabled | |
| DDR3L: | Supported | |
| Maximum Memory Size per Channel: | 64 GB (unlimited) | |
| Overclocking: | Disabled | |
| Hyper-Threading (SMT): | Supported | |
| Additive Graphics: | Supported | |
| Additive Graphics: | Enabled | |
| PCIe Gen 3: | Not Supported | |
| DMI Gen 3: | Not Supported | |
| HDCP: | Supported | |
| DDR4: | Supported | |
| LPDDR3: | Supported | |
| BCLK OC Limit: | 100 MHz | |
| Maximum Supported LPDDR3 Frequency: | 1067 MHz | |
| Maximum Supported DDR4 Frequency: | 1067 MHz | |
| SVID Status: | Enabled | |
| [Voltage Regulator (SVID)] | ||
| VCC VR: | ON Semi (0x26), IMVP8 | |
| VR Thermal Sensor: | Supported | |
| [Memory Ranges] | ||
| Maximum Physical Address Size: | 39-bit (512 GBytes) | |
| Maximum Virtual Address Size: | 48-bit (256 TBytes) | |
| [MTRRs] | ||
| Range 0-200000000 (0MB-8192MB) Type: | Write Back (WB) | |
| Range 87FFF000-88000000 (2175MB-2176MB) Type: | Uncacheable (UC) | |
| Range 88000000-90000000 (2176MB-2304MB) Type: | Uncacheable (UC) | |
| Range 90000000-A0000000 (2304MB-2560MB) Type: | Uncacheable (UC) | |
| Range A0000000-C0000000 (2560MB-3072MB) Type: | Uncacheable (UC) | |
| Range C0000000-100000000 (3072MB-4096MB) Type: | Uncacheable (UC) | |
| Motherboard |
| [Computer] | ||
| Computer Brand Name: | LENOVO Lenovo ideapad 300-14ISK | |
| [Motherboard] | ||
| Motherboard Model: | LENOVO Paris 4A8 | |
| Motherboard Chipset: | Intel Skylake-U Premium PCH | |
| Motherboard Slots: | 4xPCI Express x1, 1xPCI Express x4 | |
| PCI Express Version Supported: | v3.0 | |
| USB Version Supported: | v3.0 | |
| [BIOS] | ||
| BIOS Manufacturer: | Insyde Software | |
| BIOS Date: | 12/16/2015 | |
| BIOS Version: | D5CN43WW | |
| UEFI BIOS: | Capable | |
| Super-IO/LPC Chip: | SMSC SCH5317 | |
| ACPI Devices |
| Legacy device |
| Device Name: | Legacy device | |
| [Assigned Resources] | ||
| Memory Location: | FF000000 - FFFFFFFF | |
| [Alternative 1] | ||
| Memory Location: | FF000000 - FFFFFFFF | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 1854 - 1857 | |
| [Alternative 1] | ||
| I/O Port: | 1854 - 1857 | |
| Standard PS/2 Keyboard |
| Device Name: | Standard PS/2 Keyboard | |
| [Assigned Resources] | ||
| I/O Port: | 0060 | |
| I/O Port: | 0000 | |
| [Alternative 1] | ||
| I/O Port: | 0060 | |
| I/O Port: | 0064 | |
| IRQ: | 1 | |
| Trusted Platform Module 2.0 |
| Device Name: | Trusted Platform Module 2.0 | |
| [Assigned Resources] | ||
| Memory Location: | FED40040 - FED4103F | |
| [Alternative 1] | ||
| Memory Location: | FED40040 - FED4103F | |
| Memory Location: | FED40000 | |
| Programmable interrupt controller |
| Device Name: | Programmable interrupt controller | |
| [Assigned Resources] | ||
| I/O Port: | 0020 - 0021 | |
| I/O Port: | 0030 - 0031 | |
| I/O Port: | 00A0 - 00A1 | |
| I/O Port: | 00B0 - 00B1 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| [Alternative 1] | ||
| I/O Port: | 0020 - 0021 | |
| I/O Port: | 0024 - 0025 | |
| I/O Port: | 0028 - 0029 | |
| I/O Port: | 002C - 002D | |
| I/O Port: | 0030 - 0031 | |
| I/O Port: | 0034 - 0035 | |
| I/O Port: | 0038 - 0039 | |
| I/O Port: | 003C - 003D | |
| I/O Port: | 00A0 - 00A1 | |
| I/O Port: | 00A4 - 00A5 | |
| I/O Port: | 00A8 - 00A9 | |
| I/O Port: | 00AC - 00AD | |
| I/O Port: | 00B0 - 00B1 | |
| I/O Port: | 00B4 - 00B5 | |
| I/O Port: | 00B8 - 00B9 | |
| I/O Port: | 00BC - 00BD | |
| I/O Port: | 04D0 - 04D1 | |
| System timer |
| Device Name: | System timer | |
| [Assigned Resources] | ||
| I/O Port: | 0040 - 0043 | |
| DMA: | 0 | |
| [Alternative 1] | ||
| I/O Port: | 0040 - 0043 | |
| I/O Port: | 0050 - 0053 | |
| IRQ: | 0 | |
| High precision event timer |
| Device Name: | High precision event timer | |
| [Assigned Resources] | ||
| Memory Location: | FED00000 - FED003FF | |
| [Alternative 1] | ||
| Memory Location: | FED00000 - FED003FF | |
| PCI Express Root Complex |
| Device Name: | PCI Express Root Complex | |
| [Assigned Resources] | ||
| I/O Port: | 0000 - FFFFFFFF | |
| Memory Location: | 000A0000 - 000BFFFF | |
| [Alternative 1] | ||
| I/O Port: | 0000 - 0CF7 | |
| I/O Port: | 0D00 - FFFF | |
| Memory Location: | 000A0000 - 000BFFFF | |
| Memory Location: | 8C800000 - DFFFFFFF | |
| Memory Location: | FD000000 - FE7FFFFF | |
| System CMOS/real time clock |
| Device Name: | System CMOS/real time clock | |
| [Assigned Resources] | ||
| I/O Port: | 0070 - 0077 | |
| [Alternative 1] | ||
| I/O Port: | 0070 - 0077 | |
| IRQ: | 8 | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FED10000 - FED17FFF | |
| Memory Location: | FED20000 - FED3FFFF | |
| [Alternative 1] | ||
| Memory Location: | FED10000 - FED17FFF | |
| Memory Location: | FED18000 - FED18FFF | |
| Memory Location: | FED19000 - FED19FFF | |
| Memory Location: | E0000000 - EFFFFFFF | |
| Memory Location: | FED20000 - FED3FFFF | |
| Memory Location: | FED90000 - FED93FFF | |
| Memory Location: | FED45000 - FED8FFFF | |
| Memory Location: | FF000000 - FFFFFFFF | |
| Memory Location: | FEE00000 - FEEFFFFF | |
| Memory Location: | 8C800000 - 8C81FFFF | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 002E - 002F | |
| I/O Port: | 0065 | |
| I/O Port: | 0000 - 006F | |
| I/O Port: | 0092 | |
| I/O Port: | FFFF | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| [Alternative 1] | ||
| I/O Port: | 002E - 002F | |
| I/O Port: | 004E - 004F | |
| I/O Port: | 0061 | |
| I/O Port: | 0063 | |
| I/O Port: | 0065 | |
| I/O Port: | 0067 | |
| I/O Port: | 0070 | |
| I/O Port: | 0080 | |
| I/O Port: | 0092 | |
| I/O Port: | 00B2 - 00B3 | |
| I/O Port: | 0680 - 069F | |
| I/O Port: | FFFF | |
| I/O Port: | FFFF | |
| I/O Port: | FFFF | |
| I/O Port: | 1800 - 18FE | |
| I/O Port: | 164E - 164F | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FE029000 - FE029FFF | |
| Memory Location: | FDAC0000 - FDACFFFF | |
| [Alternative 1] | ||
| Memory Location: | FE029000 - FE029FFF | |
| Memory Location: | FE028000 - FE028FFF | |
| Memory Location: | FDAF0000 | |
| Memory Location: | FDAE0000 | |
| Memory Location: | FDAC0000 | |
| IRQ: | 14 | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FD000000 - FDABFFFF | |
| Memory Location: | FE036000 - FE03BFFF | |
| [Alternative 1] | ||
| Memory Location: | FD000000 - FDABFFFF | |
| Memory Location: | FDAD0000 - FDADFFFF | |
| Memory Location: | FDB00000 | |
| Memory Location: | FE000000 | |
| Memory Location: | FE036000 | |
| Memory Location: | FE03D000 | |
| Memory Location: | FE410000 | |
| Microsoft ACPI-Compliant Embedded Controller |
| Device Name: | Microsoft ACPI-Compliant Embedded Controller | |
| [Assigned Resources] | ||
| I/O Port: | 0062 | |
| [Alternative 1] | ||
| I/O Port: | 0062 | |
| I/O Port: | 0066 | |
| PS/2 Compatible Mouse |
| Device Name: | PS/2 Compatible Mouse | |
| [Assigned Resources] | ||
| IRQ: | 12 | |
| [Alternative 1] | ||
| IRQ: | 12 | |
| SMBIOS DMI |
| BIOS |
| BIOS Vendor: | LENOVO | |
| BIOS Version: | D5CN43WW | |
| BIOS Release Date: | 12/16/2015 | |
| BIOS Start Segment: | E000 | |
| BIOS Size: | 6080 KBytes | |
| System BIOS Version: | 1.43 | |
| Embedded Controller Firmware Version: | 1.43 | |
| ISA Support: | Not Present | |
| MCA Support: | Not Present | |
| EISA Support: | Not Present | |
| PCI Support: | Present | |
| PC Card (PCMCIA) Support: | Not Present | |
| Plug-and-Play Support: | Not Present | |
| APM Support: | Not Present | |
| Flash BIOS: | Present | |
| BIOS Shadow: | Present | |
| VL-VESA Support: | Not Present | |
| ESCD Support: | Not Present | |
| Boot from CD: | Present | |
| Selectable Boot: | Present | |
| BIOS ROM Socketed: | Not Present | |
| Boot from PC Card: | Not Present | |
| EDD Support: | Present | |
| NEC PC-98 Support: | Not Present | |
| ACPI Support: | Present | |
| USB Legacy Support: | Present | |
| AGP Support: | Not Present | |
| I2O Boot Support: | Not Present | |
| LS-120 Boot Support: | Not Present | |
| ATAPI ZIP Drive Boot Support: | Not Present | |
| IEE1394 Boot Support: | Not Present | |
| Smart Battery Support: | Not Present | |
| BIOS Boot Specification Support: | Present | |
| Function key-initiated Network Service Boot Support: | Not Present | |
| Targeted Content Distribution Support: | Present | |
| UEFI Specification Support: | Present | |
| Virtual Machine: | Not Present |
| System |
| System Manufacturer: | LENOVO | |
| Product Name: | 80Q6 | |
| Product Version: | Lenovo ideapad 300-14ISK | |
| Product Serial Number: | PF0HAXQT | |
| UUID: | {5A86C726-DD04-11E5-9614-507B9DC3CF1D} | |
| SKU Number: | LENOVO_MT_80Q6_BU_idea_FM_Lenovo ideapad 300-14ISK | |
| Family: | IDEAPAD |
| Mainboard |
| Mainboard Manufacturer: | LENOVO | |
| Mainboard Name: | Paris 4A8 | |
| Mainboard Version: | NO DPK | |
| Mainboard Serial Number: | PF0HAXQT | |
| Asset Tag: | NO Asset Tag | |
| Location in chassis: | Type2 - Board Chassis Location |
| System Enclosure |
| Manufacturer: | LENOVO | |
| Case Type: | Notebook | |
| Version: | Lenovo ideapad 300-14ISK | |
| Serial Number: | PF0HAXQT | |
| Asset Tag Number: | NO Asset Tag |
| Processor |
| Processor Manufacturer: | Intel(R) Corporation | |
| Processor Version: | Intel(R) Core(TM) i5-6200U CPU @ 2.30GHz | |
| External Clock: | 100 MHz | |
| Maximum Clock Supported: | 2400 MHz | |
| Current Clock: | 2200 MHz | |
| CPU Socket: | Populated | |
| CPU Status: | Enabled | |
| Processor Type: | Central Processor | |
| Processor Voltage: | 0.8 V | |
| Processor Upgrade: | Socket BGA1168 | |
| Socket Designation: | U3E1 |
| L1 Cache |
| Socket Designation: | L1 Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L1 Data | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Parity | |
| Maximum Cache Size: | 64 KBytes | |
| Installed Cache Size: | 64 KBytes | |
| Cache Associativity: | 8-way Set-Associative |
| L1 Cache |
| Socket Designation: | L1 Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L1 Instruction | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Parity | |
| Maximum Cache Size: | 64 KBytes | |
| Installed Cache Size: | 64 KBytes | |
| Cache Associativity: | 8-way Set-Associative |
| L2 Cache |
| Socket Designation: | L2 Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L2 Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Single-bit ECC | |
| Maximum Cache Size: | 512 KBytes | |
| Installed Cache Size: | 512 KBytes | |
| Cache Associativity: | 4-way Set-Associative |
| L3 Cache |
| Socket Designation: | L3 Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L3 Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Multi-bit ECC | |
| Maximum Cache Size: | 3072 KBytes | |
| Installed Cache Size: | 3072 KBytes | |
| Cache Associativity: | 12-way Set-Associative |
| OEM Strings |
| OemString1 | ||
| OemString2 | ||
| OemString3 |
| System Configuration Options |
| ConfigOptions1 | ||
| ConfigOptions2 | ||
| ConfigOptions3 |
| BIOS Language |
| en|US|iso8859-1,0 <Active> | ||
| fr|CA|iso8859-1,0 | ||
| zh|TW|unicode,0 | ||
| ja|JP|unicode,0 | ||
| it|IT|iso8859-1,0 | ||
| es|ES|iso8859-1,0 | ||
| de|DE|iso8859-1,0 | ||
| pt|PT|iso8859-1,0 |
| Group Associations |
| Group Associations |
| Group Associations |
| System Event Log |
| Built-in Pointing Device |
| Device Type: | Touch Pad | |
| Interface Type: | PS/2 | |
| Number of Buttons: | 4 |
| Portable Battery |
| Battery Location: | Fake | |
| Battery Manufacturer: | -Virtual Battery 0- | |
| Manufacture Date: | 08/08/2010 | |
| Serial Number: | Battery 0 | |
| Device Name: | CRB Battery 0 | |
| Device Chemistry: | Zinc Air | |
| Design Capacity: | Unknown | |
| Design Voltage: | Unknown | |
| SBDS Verison Number: | ||
| Max. Error in Battery Data: | Unknown | |
| SBDS Serial Number: | Unknown | |
| SBDS Manufacture Date: | Unknown | |
| SBDS Device Chemistry: | LithiumPolymer |
| Hardware Security |
| Power-on Password: | Disabled | |
| Keyboard Password: | Disabled | |
| Administrator Password: | Disabled | |
| Front Panel Reset: | Disabled |
| Voltage Probe |
| Description: | Voltage Probe Description | |
| Location: | Unknown | |
| Status: | Unknown | |
| Maximum Value: | Unknown | |
| Minimum Value: | Unknown | |
| Resolution: | Unknown | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| Cooling Device |
| Type: | Fan | |
| Description: | Cooling Device Description | |
| Status: | OK | |
| Nominal Speed: | 8192 RPM |
| Temperature Probe |
| Description: | Temperature Probe Description | |
| Location: | Unknown | |
| Status: | Unknown | |
| Maximum Value: | Unknown | |
| Minimum Value: | Unknown | |
| Resolution: | Unknown | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| System Boot Information |
| Boot Status: | No error occured |
| System Power Supply |
| Location: | OEM Define 0 | |
| Device Name: | OEM Define 1 | |
| Manufacturer: | OEM Define 2 | |
| Serial Number: | OEM Define 3 | |
| Asset Tag Number: | OEM Define 4 | |
| Model Part Number: | OEM Define 5 | |
| Revision Level: | OEM Define 6 | |
| Max Power Capacity: | 75 mW | |
| Power Supply Status: | Not Present | |
| Power Supply Type: | Regulator | |
| Power Status: | OK | |
| Hot replaceable: | No | |
| Unplugged from wall: | Yes |
| Additional Information |
| On Board Device |
| Device Description: | IGD | |
| Device Type: | Video Adapter | |
| Device Status: | Disabled | |
| Intel ASF |
| Intel ASF Status: | Enabled |
| Intel AMT |
| Intel AMT Support: | Supported | |
| Intel AMT Status: | Enabled | |
| IDE-R Status: | Enabled | |
| SOL Status: | Enabled | |
| Network Interface: | Enabled |
| Intel vPro |
| CPU VT-x Support: | Supported | |
| CPU VT-x Status: | Disabled | |
| CPU VT-x2 Support: | Not Supported | |
| CPU VT-x2 Status: | Disabled | |
| CPU TXT Support: | Not Supported | |
| CPU TXT Status: | Disabled | |
| CPU VMX Status: | Disabled | |
| CPU SMX Status: | Disabled | |
| Intel ME Status: | Enabled | |
| Intel OST Firmware Support: | Not Supported | |
| Intel ASF Firmware Support: | Not Supported | |
| Intel AMT Pro Firmware Support: | Not Supported | |
| Intel AMT Basic Firmware Support: | Not Supported | |
| Intel TPM Firmware Support: | Not Supported | |
| Intel Castle Peak Support: | Not Supported | |
| Intel WoX Support: | Not Supported | |
| Intel Virtualization Engine Support: | Not Supported | |
| Intel Anti-Theft Technology Support: | Not Supported | |
| TPM On-board: | Not Supported | |
| Intel Anti-Theft Technology Enrolled: | Not Supported | |
| Intel ME Version: | v11.0, Build 1160, Hotfix 0 | |
| BIOS VT-x Support: | Not Supported | |
| BIOS VT-d Support: | Supported | |
| BIOS TXT Support: | Supported | |
| BIOS TPM Support: | Not Supported | |
| BIOS ME Support: | Not Supported | |
| BIOS VA Extensions Support: | Supported | |
| Intel AT PBA For Recovery Support: | Not Supported | |
| Intel AT WWAN Support: | Not Supported |
| Firmware Version Information |
| Reference Code - CPU | 1.2.0.0 | |
| uCode Version | 0.0.0.51 | |
| TXT ACM version | 0.5.0.0 |
| Firmware Version Information |
| Reference Code - ME 11.0 | 1.2.0.0 | |
| MEBx version | 1.2.0.0 | |
| ME Firmware Version | Consumer SKU |
| Firmware Version Information |
| Reference Code - SKL PCH | 1.2.0.0 | |
| PCH-CRID Status | Disabled | |
| PCH-CRID Original Value | 0x21 | |
| PCH-CRID New Value | 0x21 | |
| OPROM - RST - RAID | ||
| SKL PCH H Bx Hsio Version | 62.0.0.0 | |
| SKL PCH H Dx Hsio Version | 49.0.0.0 | |
| SKL PCH LP Bx Hsio Version | 62.0.0.0 | |
| SKL PCH LP Cx Hsio Version | 49.0.0.0 |
| Firmware Version Information |
| Reference Code - SA - System Agent | 1.2.0.0 | |
| Reference Code - MRC | 1.2.0.0 | |
| SA - PCIe Version | 1.2.0.0 | |
| SA-CRID Status | Disabled | |
| SA-CRID Original Value | 0x8 | |
| SA-CRID New Value | 0x8 | |
| OPROM - VBIOS | Build: 0 |
| Memory Devices |
| Physical Memory Array |
| Array Location: | System board | |
| Array Use: | System memory | |
| Error Detecting Method: | None | |
| Memory Capacity: | 16 GBytes | |
| Memory Devices: | 2 |
| Memory Device |
| Total Width: | 64 bits | |
| Data Width: | 64 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | SODIMM | |
| Device Locator: | ChannelA-DIMM0 | |
| Bank Locator: | BANK 0 | |
| Device Type: | DDR3 SDRAM | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 1600 MHz | |
| Manufacturer: | Samsung | |
| Serial Number: | 49112515 | |
| Part Number: | M471B5173EB0-YK0 | |
| Asset Tag: | 9876543210 |
| Memory Device |
| Total Width: | 0 bits | |
| Data Width: | 0 bits | |
| Device Size: | 0 MBytes | |
| Device Form Factor: | Unknown | |
| Device Locator: | ChannelA-DIMM1 | |
| Bank Locator: | BANK 1 | |
| Device Type: | Unknown | |
| Device Type Detail: | ||
| Manufacturer: | ||
| Serial Number: | ||
| Part Number: | ||
| Asset Tag: |
| Memory Device |
| Total Width: | 0 bits | |
| Data Width: | 0 bits | |
| Device Size: | 0 MBytes | |
| Device Form Factor: | Unknown | |
| Device Locator: | ChannelB-DIMM0 | |
| Bank Locator: | BANK 2 | |
| Device Type: | Unknown | |
| Device Type Detail: | ||
| Manufacturer: | ||
| Serial Number: | ||
| Part Number: | ||
| Asset Tag: |
| Memory Device |
| Total Width: | 0 bits | |
| Data Width: | 0 bits | |
| Device Size: | 0 MBytes | |
| Device Form Factor: | Unknown | |
| Device Locator: | ChannelB-DIMM1 | |
| Bank Locator: | BANK 3 | |
| Device Type: | Unknown | |
| Device Type Detail: | ||
| Manufacturer: | ||
| Serial Number: | ||
| Part Number: | ||
| Asset Tag: |
| Memory Array Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 003FFFFF | |
| Partition Width: | 1 |
| Memory Device Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 003FFFFF | |
| Partition Row Position: | Unknown | |
| Interleave Position: | 1 | |
| Interleave Data Depth: | 1 |
| Memory Device Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 0 | |
| Partition Row Position: | Unknown | |
| Interleave Position: | 2 | |
| Interleave Data Depth: | 1 |
| Port Connectors |
| Keyboard Port |
| Port Type: | Keyboard Port | |
| Internal Reference: | J1A1 | |
| Internal Connector Type: | None | |
| External Reference: | Keyboard | |
| External Connector Type: | PS/2 |
| Mouse Port |
| Port Type: | Mouse Port | |
| Internal Reference: | J1A1 | |
| Internal Connector Type: | None | |
| External Reference: | Mouse | |
| External Connector Type: | PS/2 |
| Video Port |
| Port Type: | Video Port | |
| Internal Reference: | J2A1 | |
| Internal Connector Type: | None | |
| External Reference: | TV OUT | |
| External Connector Type: | Mini-DIN |
| Video Port |
| Port Type: | Video Port | |
| Internal Reference: | J2A2 | |
| Internal Connector Type: | None | |
| External Reference: | CRT | |
| External Connector Type: | DB-15 pin female |
| Serial Port 16550A Compatible |
| Port Type: | Serial Port 16550A Compatible | |
| Internal Reference: | J2A2 | |
| Internal Connector Type: | None | |
| External Reference: | COM 1 | |
| External Connector Type: | DB-9 pin male |
| USB |
| Port Type: | USB | |
| Internal Reference: | J3A1 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J3A1 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J3A1 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J5A1 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J5A1 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J5A2 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| Network Port |
| Port Type: | Network Port | |
| Internal Reference: | J5A1 | |
| Internal Connector Type: | None | |
| External Reference: | Network | |
| External Connector Type: | RJ-45 |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J9G2 | |
| Internal Connector Type: | On Board Floppy | |
| External Reference: | OnBoard Floppy Type | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J7J1 | |
| Internal Connector Type: | On Board IDE | |
| External Reference: | OnBoard Primary IDE | |
| External Connector Type: | None |
| Audio Port |
| Port Type: | Audio Port | |
| Internal Reference: | J30 | |
| Internal Connector Type: | None | |
| External Reference: | Microphone In | |
| External Connector Type: | Mini-jack (headphones) |
| Audio Port |
| Port Type: | Audio Port | |
| Internal Reference: | J30 | |
| Internal Connector Type: | None | |
| External Reference: | Line In | |
| External Connector Type: | Mini-jack (headphones) |
| Audio Port |
| Port Type: | Audio Port | |
| Internal Reference: | J30 | |
| Internal Connector Type: | None | |
| External Reference: | Speaker Out | |
| External Connector Type: | Mini-jack (headphones) |
| System Slots |
| J6C1 |
| Slot Designation: | J6C1 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | In use | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Unknown |
| J6D2 |
| Slot Designation: | J6D2 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Unknown |
| J7C1 |
| Slot Designation: | J7C1 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Unknown |
| J7D1 |
| Slot Designation: | J7D1 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Unknown |
| J8C1 |
| Slot Designation: | J8C1 | |
| Slot Type: | PCI Express x4 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 4x / x4 | |
| Slot Length: | Unknown |
| Memory |
| [General information] | ||
| Total Memory Size: | 8 GBytes | |
| Total Memory Size [MB]: | 8192 | |
| [Current Performance Settings] | ||
| Current Memory Clock: | 798.0 MHz (8 : 1 ratio) | |
| Current Timing (tCAS-tRCD-tRP-tRAS): | 11-11-11-28 | |
| Memory Channels Supported: | 2 | |
| Memory Channels Active: | 1 | |
| Command Rate: | 1T | |
| Read to Read Delay (tRD_RD) Same Rank: | 4T | |
| Read to Read Delay (tRD_RD) Different Rank: | 4T | |
| Read to Read Delay (tRD_RD) Different DIMM: | 7T | |
| Write to Write Delay (tWR_WR) Same Rank: | 4T | |
| Write to Write Delay (tWR_WR) Different Rank: | 4T | |
| Write to Write Delay (tWR_WR) Different DIMM: | 7T | |
| Read to Write Delay (tRD_WR) Same Rank: | 10T | |
| Read to Write Delay (tRD_WR) Different Rank: | 10T | |
| Read to Write Delay (tRD_WR) Different DIMM: | 12T | |
| Write to Read Delay (tWR_RD) Same Rank (tWTR): | 19T | |
| Write to Read Delay (tWR_RD) Different Rank: | 19T | |
| Write to Read Delay (tWR_RD) Different DIMM: | 4T | |
| RAS# to RAS# Delay (tRRD): | 5T | |
| Refresh Cycle Time (tRFC): | 208T | |
| Four Activate Window (tFAW): | 24T | |
| Row: 0 - 4 GB PC3-12800 DDR3 SDRAM Samsung M471B5173EB0-YK0 |
| [General Module Information] | ||
| Module Number: | 0 | |
| Module Size: | 4 GBytes | |
| Memory Type: | DDR3 SDRAM | |
| Module Type: | SO-DIMM | |
| Memory Speed: | 800.0 MHz (DDR3-1600 / PC3-12800) | |
| Module Manufacturer: | Samsung | |
| Module Part Number: | M471B5173EB0-YK0 | |
| Module Revision: | 0 | |
| Module Serial Number: | 2566812977 | |
| Module Manufacturing Date: | Year: 2016, Week: 5 | |
| Module Manufacturing Location: | 2 | |
| SDRAM Manufacturer: | Samsung | |
| Error Check/Correction: | None | |
| [Module characteristics] | ||
| Row Address Bits: | 16 | |
| Column Address Bits: | 10 | |
| Number Of Banks: | 8 | |
| Module Density: | 4096 Mb | |
| Number Of Ranks: | 1 | |
| Device Width: | 8 bits | |
| Bus Width: | 64 bits | |
| Module Nominal Voltage (VDD): | 1.5 V, 1.35 V | |
| [Module timing] | ||
| Minimum SDRAM Cycle Time (tCKmin): | 1.250 ns | |
| CAS# Latencies Supported: | 5, 6, 7, 8, 9, 10, 11 | |
| Minimum CAS# Latency Time (tAAmin): | 13.125 ns | |
| Minimum RAS# to CAS# Delay (tRCDmin): | 13.125 ns | |
| Minimum Row Precharge Time (tRPmin): | 13.125 ns | |
| Minimum Active to Precharge Time (tRASmin): | 35.000 ns | |
| Supported Module Timing at 800.0 MHz: | 11-11-11-28 | |
| Supported Module Timing at 666.7 MHz: | 9-9-9-24 | |
| Supported Module Timing at 533.3 MHz: | 7-7-7-19 | |
| Supported Module Timing at 400.0 MHz: | 6-6-6-14 | |
| Supported Module Timing at 333.3 MHz: | 5-5-5-12 | |
| Minimum Write Recovery Time (tWRmin): | 15.000 ns | |
| Minimum Row Active to Row Active Delay (tRRDmin): | 6.000 ns | |
| Minimum Active to Active/Refresh Time (tRCmin): | 48.125 ns | |
| Minimum Refresh Recovery Time Delay (tRFCmin): | 260.000 ns | |
| Minimum Internal Write to Read Command Delay (tWTRmin): | 7.500 ns | |
| Minimum Internal Read to Precharge Command Delay (tRTPmin): | 7.500 ns | |
| Minimum Four Activate Window Delay Time (tFAWmin): | 30.000 ns | |
| [Features] | ||
| Partial Array Self Refresh (PASR): | Not Supported | |
| On-die Thermal Sensor (ODTS) Readout: | Not Supported | |
| Auto Self Refresh (ASR): | Not Supported | |
| Extended Temperature 1X Refresh Rate: | Not Supported | |
| Extended Temperature Range: | Supported | |
| Module Temperature Sensor: | Not Supported | |
| Pseudo Target Row Refresh (pTRR): | Supported | |
| Maximum Active Window (MAW): | 64 mS | |
| Unlimited MAC: | Supported | |
| Maximum Active Window (MAW): | Unknown (not tested) | |
| Module Nominal Height: | 29 - 30 mm | |
| Module Maximum Thickness (Front): | 1 - 2 mm | |
| Module Maximum Thickness (Back): | 1 - 2 mm | |
| Row: 2 - 4 GB PC3-12800 DDR3 SDRAM Samsung M471B5173BH0-CK0 |
| [General Module Information] | ||
| Module Number: | 2 | |
| Module Size: | 4 GBytes | |
| Memory Type: | DDR3 SDRAM | |
| Module Type: | SO-DIMM | |
| Memory Speed: | 800.0 MHz (DDR3-1600 / PC3-12800) | |
| Module Manufacturer: | Samsung | |
| Module Part Number: | M471B5173BH0-CK0 | |
| Module Revision: | 0 | |
| Module Serial Number: | 3649823506 | |
| Module Manufacturing Date: | Year: 2013, Week: 19 | |
| Module Manufacturing Location: | 3 | |
| SDRAM Manufacturer: | Samsung | |
| Error Check/Correction: | None | |
| [Module characteristics] | ||
| Row Address Bits: | 16 | |
| Column Address Bits: | 10 | |
| Number Of Banks: | 8 | |
| Module Density: | 4096 Mb | |
| Number Of Ranks: | 1 | |
| Device Width: | 8 bits | |
| Bus Width: | 64 bits | |
| Module Nominal Voltage (VDD): | 1.5 V | |
| [Module timing] | ||
| Minimum SDRAM Cycle Time (tCKmin): | 1.250 ns | |
| CAS# Latencies Supported: | 5, 6, 7, 8, 9, 10, 11 | |
| Minimum CAS# Latency Time (tAAmin): | 13.125 ns | |
| Minimum RAS# to CAS# Delay (tRCDmin): | 13.125 ns | |
| Minimum Row Precharge Time (tRPmin): | 13.125 ns | |
| Minimum Active to Precharge Time (tRASmin): | 35.000 ns | |
| Supported Module Timing at 800.0 MHz: | 11-11-11-28 | |
| Supported Module Timing at 666.7 MHz: | 9-9-9-24 | |
| Supported Module Timing at 533.3 MHz: | 7-7-7-19 | |
| Supported Module Timing at 400.0 MHz: | 6-6-6-14 | |
| Supported Module Timing at 333.3 MHz: | 5-5-5-12 | |
| Minimum Write Recovery Time (tWRmin): | 15.000 ns | |
| Minimum Row Active to Row Active Delay (tRRDmin): | 6.000 ns | |
| Minimum Active to Active/Refresh Time (tRCmin): | 48.125 ns | |
| Minimum Refresh Recovery Time Delay (tRFCmin): | 260.000 ns | |
| Minimum Internal Write to Read Command Delay (tWTRmin): | 7.500 ns | |
| Minimum Internal Read to Precharge Command Delay (tRTPmin): | 7.500 ns | |
| Minimum Four Activate Window Delay Time (tFAWmin): | 30.000 ns | |
| [Features] | ||
| Partial Array Self Refresh (PASR): | Not Supported | |
| On-die Thermal Sensor (ODTS) Readout: | Not Supported | |
| Auto Self Refresh (ASR): | Not Supported | |
| Extended Temperature 1X Refresh Rate: | Not Supported | |
| Extended Temperature Range: | Supported | |
| Module Temperature Sensor: | Not Supported | |
| Pseudo Target Row Refresh (pTRR): | Not Supported | |
| Module Nominal Height: | 29 - 30 mm | |
| Module Maximum Thickness (Front): | 1 - 2 mm | |
| Module Maximum Thickness (Back): | 1 - 2 mm | |
| Bus |
| PCI Bus #0 |
| Intel Skylake-U - Host Bridge/DRAM Controller [D0] |
| [General Information] | ||
| Device Name: | Intel Skylake-U - Host Bridge/DRAM Controller [D0] | |
| Original Device Name: | Intel Skylake-U - Host Bridge/DRAM Controller [D0] | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 8 [D0] | |
| PCI Address (Bus:Device:Function) Number: | 0:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_1904&SUBSYS_380817AA&REV_08 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standard system devices) | |
| Driver Description: | PCI standard host CPU bridge | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_1904&SUBSYS_380817AA&REV_08\3&11583659&0&00 | |
| Location Paths | PCIROOT(0)#PCI(0000) | |
| Intel HD Graphics 520 (Skylake-U GT2) [D0/D1] |
| [General Information] | ||
| Device Name: | Intel HD Graphics 520 (Skylake-U GT2) [D0/D1] | |
| Original Device Name: | Intel HD Graphics 520 (Skylake-U GT2) [D0/D1] | |
| Device Class: | VGA Compatible Adapter | |
| Revision ID: | 7 [D0/D1] | |
| PCI Address (Bus:Device:Function) Number: | 0:2:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_1916&SUBSYS_380817AA&REV_07 | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Current Link Width: | Not negotiated | |
| Device/Port Type: | Root Complex Integrated Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | None | |
| Active State Power Management (ASPM) Status: | Disabled | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | IRQ11 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | A0000000 | |
| Memory Base Address 2 | 90000000 | |
| I/O Base Address 4 | 4000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standard display types) | |
| Driver Description: | Microsoft Basic Display Adapter | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.1 | |
| Driver Date: | 21-Jun-2006 | |
| DCH/UWD Driver: | Not Capable | |
| DeviceInstanceId | PCI\VEN_8086&DEV_1916&SUBSYS_380817AA&REV_07\3&11583659&0&10 | |
| Location Paths | PCIROOT(0)#PCI(0200) | |
| Intel Skylake-U/Y PCH - USB 3.0 xHCI Controller [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - USB 3.0 xHCI Controller [C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - USB 3.0 xHCI Controller [C1] | |
| Device Class: | USB xHCI Controller | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:20:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D2F&SUBSYS_380817AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | A1300000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| USB Version Supported: | 3.0 | |
| [Driver Information] | ||
| Driver Manufacturer: | Generic USB xHCI Host Controller | |
| Driver Description: | USB xHCI Compliant Host Controller | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.488 | |
| Driver Date: | 01-Sep-2020 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D2F&SUBSYS_380817AA&REV_21\3&11583659&0&A0 | |
| Location Paths | PCIROOT(0)#PCI(1400) | |
| USB Root Hub |
| [Port1] : Transcend USB Mass Storage Device |
| [Device Information] | ||
| Device Manufacturer: | JetFlash | |
| Product Name: | Mass Storage Device | |
| Serial Number: | 06E8X07J0S1IOGTP | |
| USB Version Supported: | 3.00 (Connected to a USB 2.00 Port) | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | USB Mass Storage Device | |
| Hardware ID: | USB\VID_8564&PID_1000 | |
| [Driver Information] | ||
| Driver Manufacturer: | Compatible USB storage device | |
| Driver Description: | USB Mass Storage Device | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_8564&PID_1000\06E8X07J0S1IOGTP | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(1) | |
| [Port2] : Microsoft USB Wireless Mouse (IntelliPoint) |
| [Device Information] | ||
| Device Manufacturer: | Microsoft | |
| Product Name: | Microsoft® Nano Transceiver v2.0 | |
| Serial Number: | N/A | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | USB Composite Device | |
| Hardware ID: | USB\VID_045E&PID_0745 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standard USB Host Controller) | |
| Driver Description: | USB Composite Device | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.488 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_045E&PID_0745\5&2889B90E&0&2 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(2) | |
| [Port3] : No Device Connected |
| [Port4] : Chicony Electronics Lenovo EasyCamera |
| [Device Information] | ||
| Device Manufacturer: | Chicony Electronics | |
| Product Name: | Chicony Electronics Lenovo EasyCamera | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | USB Composite Device | |
| Hardware ID: | USB\VID_04F2&PID_B50E | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standard USB Host Controller) | |
| Driver Description: | USB Composite Device | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.488 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_04F2&PID_B50E\0001 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(4) | |
| [Port5] : Realtek Semiconductor Realtek USB 2.0 Card Reader |
| [Device Information] | ||
| Device Manufacturer: | Realtek Semiconductor | |
| Product Name: | Realtek Semiconductor Realtek USB 2.0 Card Reader | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | ||
| Hardware ID: | USB\VID_0BDA&PID_0129 | |
| [Port6] : No Device Connected |
| [Port7] : Atheros Communications Qualcomm Atheros QCA9377 Bluetooth 4.1 |
| [Device Information] | ||
| Device Manufacturer: | Atheros Communications Qualcomm Atheros Valkyrie BootROM | |
| Product Name: | Atheros Communications Qualcomm Atheros QCA9377 Bluetooth 4.1 | |
| Serial Number: | - | |
| USB Version Supported: | 2.01 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Generic Bluetooth Adapter | |
| Hardware ID: | USB\VID_0CF3&PID_E360 | |
| [Driver Information] | ||
| Driver Manufacturer: | GenericAdapter | |
| Driver Description: | Generic Bluetooth Adapter | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.488 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_0CF3&PID_E360\5&2889B90E&0&7 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(7) | |
| [Port8] : No Device Connected |
| [Port9] : No Device Connected |
| [Port10] : No Device Connected |
| [Port11] : No Device Connected |
| [Port12] : No Device Connected |
| [Port13] : No Device Connected |
| [Port14] : No Device Connected |
| [Port15] : No Device Connected |
| [Port16] : No Device Connected |
| [Port17] : No Device Connected |
| [Port18] : No Device Connected |
| Intel Skylake/Kaby Lake-U/Y PCH - Thermal Subsystem [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake/Kaby Lake-U/Y PCH - Thermal Subsystem [C1] | |
| Original Device Name: | Intel Skylake/Kaby Lake-U/Y PCH - Thermal Subsystem [C1] | |
| Device Class: | Other Data Acquisition/Signal Processing Controller | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:20:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D31&SUBSYS_380817AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | IRQ11 | |
| Interrupt Pin: | INTC# | |
| Memory Base Address 0 | A132A000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D31&SUBSYS_380817AA&REV_21\3&11583659&0&A2 | |
| Location Paths | PCIROOT(0)#PCI(1402) | |
| Intel Skylake-U/Y PCH - CSME: HECI #1 [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - CSME: HECI #1 [C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - CSME: HECI #1 [C1] | |
| Device Class: | Other Communication Device | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:22:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D3A&SUBSYS_380817AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | IRQ11 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | A132B000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D3A&SUBSYS_380817AA&REV_21\3&11583659&0&B0 | |
| Location Paths | PCIROOT(0)#PCI(1600) | |
| Intel Skylake-U/Y PCH - SATA AHCI Controller [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - SATA AHCI Controller [C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - SATA AHCI Controller [C1] | |
| Device Class: | SATA AHCI Controller | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:23:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D03&SUBSYS_380817AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | A1328000 | |
| Memory Base Address 1 | A132E000 | |
| I/O Base Address 2 | 4080 | |
| I/O Base Address 3 | 4088 | |
| I/O Base Address 4 | 4060 | |
| Memory Base Address 5 | A132C000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [SATA Host Controller] | ||
| Interface Speed Supported: | Gen3 6.0 Gbps | |
| Number Of Ports: | 2 | |
| External SATA Support: | Not Capable | |
| Aggressive Link Power Management: | Capable | |
| Staggered Spin-up: | Not Capable | |
| Mechanical Presence Switch: | Not Capable | |
| Command Queue Acceleration: | Capable | |
| 64-bit Addressing: | Capable | |
| AHCI Status: | Enabled | |
| AHCI Version: | 1.31 | |
| Ports Implemented: | 0, 1 | |
| [SATA Port#0] | ||
| Port Status: | Device Present, Phy communication established | |
| Current Interface Speed: | Gen3 6.0 Gbps | |
| External SATA Port: | Not Capable | |
| Hot Plug: | Not Capable | |
| Device Type: | SATA | |
| [SATA Port#1] | ||
| Port Status: | Device Present, Phy communication established | |
| Current Interface Speed: | Gen1 1.5 Gbps | |
| External SATA Port: | Not Capable | |
| Hot Plug: | Not Capable | |
| Device Type: | SATA | |
| [Driver Information] | ||
| Driver Manufacturer: | Standard SATA AHCI Controller | |
| Driver Description: | Standard SATA AHCI Controller | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.488 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D03&SUBSYS_380817AA&REV_21\3&11583659&0&B8 | |
| Location Paths | PCIROOT(0)#PCI(1700) | |
| Intel Skylake-U/Y PCH - PCI Express Root Port #5 [A1/C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - PCI Express Root Port #5 [A1/C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - PCI Express Root Port #5 [A1/C1] | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | F1 [A1/C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:28:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D14&SUBSYS_00000000&REV_F1 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Not Capable | |
| Hot-Plug Surprise: | Not Capable | |
| Slot Power Limit: | 10.000 W | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | Disabled | |
| L0s Exit Latency: | 512 ns - 1 us | |
| L1 Exit Latency: | 8 - 16 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standard system devices) | |
| Driver Description: | PCI Express Root Port | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.488 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D14&SUBSYS_380817AA&REV_F1\3&11583659&0&E0 | |
| Location Paths | PCIROOT(0)#PCI(1C00) | |
| PCI Express x1 Bus #1 |
| RealTek Semiconductor RTL8168/8111 PCI-E Gigabit Ethernet NIC |
| [General Information] | ||
| Device Name: | RealTek Semiconductor RTL8168/8111 PCI-E Gigabit Ethernet NIC | |
| Original Device Name: | RealTek Semiconductor RTL8168/8111 PCI-E Gigabit Ethernet NIC | |
| Device Class: | Ethernet Adapter | |
| Revision ID: | 15 | |
| PCI Address (Bus:Device:Function) Number: | 1:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_10EC&DEV_8168&SUBSYS_383717AA&REV_15 | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 2.5 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | Disabled | |
| L0s Exit Latency: | >4 us | |
| L1 Exit Latency: | 32 - 64 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| I/O Base Address 0 | 3000 | |
| Memory Base Address 2 | A1204000 | |
| Memory Base Address 4 | A1200000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Realtek | |
| Driver Description: | Realtek PCIe GbE Family Controller | |
| Driver Provider: | Microsoft | |
| Driver Version: | 9.1.410.2015 | |
| Driver Date: | 10-Apr-2015 | |
| DeviceInstanceId | PCI\VEN_10EC&DEV_8168&SUBSYS_383717AA&REV_15\01000000684CE00000 | |
| Location Paths | PCIROOT(0)#PCI(1C00)#PCI(0000) | |
| Intel Skylake-U/Y PCH - PCI Express Root Port #6 [A1/C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - PCI Express Root Port #6 [A1/C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - PCI Express Root Port #6 [A1/C1] | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | F1 [A1/C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:28:5 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D15&SUBSYS_00000000&REV_F1 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Not Capable | |
| Hot-Plug Surprise: | Not Capable | |
| Slot Power Limit: | 10.000 W | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 512 ns - 1 us | |
| L1 Exit Latency: | 8 - 16 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 256 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTB# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standard system devices) | |
| Driver Description: | PCI Express Root Port | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.488 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D15&SUBSYS_380817AA&REV_F1\3&11583659&0&E5 | |
| Location Paths | PCIROOT(0)#PCI(1C05) | |
| PCI Express x1 Bus #2 |
| Atheros/Qualcomm QCA9377 802.11ac Wireless Network Adapter |
| [General Information] | ||
| Device Name: | Atheros/Qualcomm QCA9377 802.11ac Wireless Network Adapter | |
| Original Device Name: | Atheros/Qualcomm QCA9377 802.11ac Wireless Network Adapter | |
| Device Class: | Other Network Adapter | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 2:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_168C&DEV_0042&SUBSYS_403517AA&REV_30 | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 2.5 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 2 - 4 us | |
| L1 Exit Latency: | 32 - 64 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 256 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | A1000000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Qualcomm Atheros Communications Inc. | |
| Driver Description: | Qualcomm Atheros QCA9377 Wireless Network Adapter | |
| Driver Provider: | Microsoft | |
| Driver Version: | 12.0.0.722 | |
| Driver Date: | 22-Aug-2018 | |
| DeviceInstanceId | PCI\VEN_168C&DEV_0042&SUBSYS_403517AA&REV_30\4&10331FD6&0&00E5 | |
| Location Paths | PCIROOT(0)#PCI(1C05)#PCI(0000) | |
| Intel Skylake-U Premium PCH - LPC/eSPI Controller [C1/J1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U Premium PCH - LPC/eSPI Controller [C1/J1] | |
| Original Device Name: | Intel Skylake-U Premium PCH - LPC/eSPI Controller [C1/J1] | |
| Device Class: | PCI-to-ISA Bridge | |
| Revision ID: | 21 [C1/J1] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D48&SUBSYS_380817AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standard system devices) | |
| Driver Description: | PCI standard ISA bridge | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D48&SUBSYS_380817AA&REV_21\3&11583659&0&F8 | |
| Location Paths | PCIROOT(0)#PCI(1F00) | |
| Intel Skylake/Kaby Lake-U/Y/ PCH - Power Management Controller [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake/Kaby Lake-U/Y/ PCH - Power Management Controller [C1] | |
| Original Device Name: | Intel Skylake/Kaby Lake-U/Y/ PCH - Power Management Controller [C1] | |
| Device Class: | Other Memory | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D21&SUBSYS_380817AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| Memory Base Address 0 | A1324000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D21&SUBSYS_380817AA&REV_21\3&11583659&0&FA | |
| Location Paths | PCIROOT(0)#PCI(1F02) | |
| Intel Skylake-U/Y PCH - High Definition Audio Controller [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - High Definition Audio Controller [C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - High Definition Audio Controller [C1] | |
| Device Class: | High Definition Audio | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:3 | |
| PCI Latency Timer: | 32 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D70&SUBSYS_380817AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | IRQ16 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | A1320000 | |
| Memory Base Address 4 | A1310000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Microsoft | |
| Driver Description: | High Definition Audio Controller | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.1 | |
| Driver Date: | 06-Dec-2019 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D70&SUBSYS_380817AA&REV_21\3&11583659&0&FB | |
| Location Paths | PCIROOT(0)#PCI(1F03) | |
| Intel Skylake/Kaby Lake-U/Y PCH - SMBus Host Controller [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake/Kaby Lake-U/Y PCH - SMBus Host Controller [C1] | |
| Original Device Name: | Intel Skylake/Kaby Lake-U/Y PCH - SMBus Host Controller [C1] | |
| Device Class: | SMBus (System Management Bus) | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:4 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D23&SUBSYS_380817AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | IRQ11 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | A132D000 | |
| I/O Base Address 4 | 4040 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D23&SUBSYS_380817AA&REV_21\3&11583659&0&FC | |
| Location Paths | PCIROOT(0)#PCI(1F04) | |
| Video Adapter |
| Intel HD Graphics 520 |
| [Video chipset] | ||
| Video Chipset: | Intel HD Graphics 520 | |
| Video Chipset Codename: | Skylake-U GT2 | |
| Video Memory: | Unknown | |
| [Video Card] | ||
| Video Card: | Intel HD Graphics 520 (Skylake-U GT2) [D0/D1] [Lenovo] | |
| Video Bus: | Integrated | |
| Video BIOS Version: | 1033 PC 14.34 11/05/2015 03:43:33 | |
| [Performance] | ||
| Video Unit Clock: | 400.0 MHz | |
| Graphics Memory Clock: | 798.0 MHz | |
| Hardware ID: | PCI\VEN_8086&DEV_1916&SUBSYS_380817AA&REV_07 | |
| PCI Location (Bus:Dev:Fnc): | 0:02:0 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standard display types) | |
| Driver Description: | Microsoft Basic Display Adapter | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.1 | |
| Driver Date: | 21-Jun-2006 | |
| DCH/UWD Driver: | Not Capable | |
| DeviceInstanceId | PCI\VEN_8086&DEV_1916&SUBSYS_380817AA&REV_07\3&11583659&0&10 | |
| Location Paths | PCIROOT(0)#PCI(0200) | |
| Monitor |
| BOE [Unknown Model: BOE05F0] |
| [General information] | ||
| Monitor Name: | BOE [Unknown Model: BOE05F0] | |
| Monitor Name (Manuf): | BOE DT HB140WX1-301 | |
| Serial Number: | Unknown | |
| Date Of Manufacture: | Week: 1, Year: 2014 | |
| Monitor Hardware ID: | Monitor\BOE05F0 | |
| Max. Vertical Size: | 17 cm | |
| Max. Horizontal Size: | 31 cm | |
| [Advanced parameters] | ||
| Input Signal: | Digital | |
| Color Bit Depth: | 6 Bits per Primary Color | |
| Digital Video Interface Standard Supported: | DisplayPort | |
| Gamma Factor: | 2.20 | |
| [DPMS Modes] | ||
| Standby: | Not Supported | |
| Suspend: | Not Supported | |
| Active Off: | Not Supported | |
| Standard Colour Space (sRGB) Default: | Not Supported | |
| Preferred Timing Mode: | Supported | |
| Default GTF (Continuous Frequency): | Not Supported | |
| DFP 1.x Compatible: | Yes | |
| [Supported Video Modes] | ||
| 1366 x 768 | 309 x 173 mm, Pixel Clock 72.30 MHz | |
| Drives |
| (S)ATA/ATAPI Drives |
| TS240GSSD220S |
| [General Information] | ||
| Drive Controller: | Serial ATA 6Gb/s @ 6Gb/s | |
| Host Controller: | Intel Skylake-U/Y PCH - SATA AHCI Controller [C1] | |
| Drive Model: | TS240GSSD220S | |
| Drive Firmware Revision: | S1031B0 | |
| Drive Serial Number: | G198920275 | |
| World Wide Name: | 57C35481AD16CE53 | |
| Drive Capacity: | 228,936 MBytes (240 GB) | |
| Drive Capacity [MB]: | 228936 | |
| Media Rotation Rate: | SSD Drive (Non-rotating) | |
| Nominal Form Factor: | 2.5" | |
| ATA Major Version Supported: | ATA/ATAPI-5, ATA/ATAPI-6, ATA/ATAPI-7, ATA8-ACS, ACS-2 | |
| ATA Minor Version Supported: | ACS-2 Revision 3 | |
| ATA Transport Version Supported: | SATA 3.2 | |
| [Drive Geometry] | ||
| Number of Cylinders: | 16383 | |
| Number of Heads: | 16 | |
| Sectors Per Track: | 63 | |
| Number of Sectors: | 16514064 | |
| Total 32-bit LBA Sectors: | 268435455 | |
| Total 48-bit LBA Sectors: | 468862128 | |
| Logical Sector Size: | 512 Bytes | |
| Cache Buffer Size: | N/A | |
| [Transfer Modes] | ||
| Sectors Per Interrupt: | Total: 1, Active: 1 | |
| Max. PIO Transfer Mode: | 4 | |
| Multiword DMA Mode: | Total: 2, Active: - | |
| Singleword DMA Mode: | Total: -, Active: - | |
| Ultra-DMA Mode: | Total: 6 (ATA-133), Active: 6 (ATA-133) | |
| Max. Multiword DMA Transfer Rate: | 16.7 MBytes/s | |
| Max. PIO with IORDY Transfer Rate: | 16.7 MBytes/s | |
| Max. PIO w/o IORDY Transfer Rate: | 16.7 MBytes/s | |
| Native Command Queuing: | Supported, Max. Depth: 32 | |
| TRIM Command: | Supported (Deterministic Read After TRIM, Any Value) | |
| [Device flags] | ||
| Fixed Drive: | Present | |
| Removable Drive: | Not Present | |
| Magnetic Storage: | Present | |
| LBA Mode: | Supported | |
| DMA Mode: | Supported | |
| IORDY: | Supported | |
| IORDY Disableable: | Supported | |
| [Features] | ||
| Write Cache: | Present, Active | |
| S.M.A.R.T. Feature: | Present, Active | |
| Security Feature: | Present, Inactive | |
| Removable Media Feature: | Not Present, Disabled | |
| Power Management: | Present, Active | |
| Advanced Power Management: | Present, Active | |
| Packet Interface: | Not Present, Disabled | |
| Look-Ahead Buffer: | Present, Active | |
| Host Protected Area: | Present, Enabled | |
| Power-Up In Standby: | Not Suppported, Inactive | |
| Automatic Acoustic Management: | Not Suppported, Inactive | |
| 48-bit LBA: | Supported, Active | |
| Host-Initiated Link Power Management: | Not Supported | |
| Device-Initiated Link Power Management: | Supported, Disabled | |
| In-Order Data Delivery: | Not Supported | |
| Hardware Feature Control: | Not Supported | |
| Software Settings Preservation: | Supported, Enabled | |
| NCQ Autosense: | Not Supported | |
| Link Power State Device Sleep: | Supported, Disabled | |
| Hybrid Information Feature: | Not Supported | |
| Rebuild Assist: | Not Supported | |
| Power Disable: | Not Supported | |
| All Write Cache Non-Volatile: | Not Supported | |
| Extended Number of User Addressable Sectors: | Not Supported | |
| CFast Specification: | Not Supported | |
| NCQ Priority Information: | Not Supported | |
| Host Automatic Partial to Slumber Transitions: | Not Supported | |
| Device Automatic Partial to Slumber Transitions: | Not Supported | |
| NCQ Streaming: | Not Supported | |
| NCQ Queue Management Command: | Not Supported | |
| DevSleep to Reduced Power State: | Not Supported | |
| Out Of Band Management Interface: | Not Supported | |
| Extended Power Conditions Feature: | Not Supported | |
| Sense Data Reporting Feature: | Not Supported | |
| Free-Fall Control Feature: | Not Supported | |
| Write-Read-Verify Feature: | Not Supported | |
| [Security] | ||
| Security Feature: | Supported | |
| Security Status: | Disabled | |
| Security Locked: | Disabled | |
| Security Frozen: | Enabled | |
| Enhanced Security Erase: | Supported | |
| Sanitize Feature: | Supported | |
| Sanitize Device - Crypto Scramble: | Not Supported | |
| Sanitize Device - Overwrite: | Not Supported | |
| Sanitize Device - Block Erase: | Supported | |
| Sanitize Device - Antifreeze Lock: | Not Supported | |
| Device Encrypts All User Data: | Not Supported | |
| Trusted Computing: | Not Supported | |
| [Self-Monitoring, Analysis and Reporting Technology (S.M.A.R.T.)] | ||
| [01] Raw Read Error Rate: | 100/50, Worst: 100 | |
| [05] Reallocated Sector Count: | 100/50, Worst: 100 | |
| [09] Power-On Hours/Cycle Count: | 100/50, Worst: 100 | |
| [0C] Power Cycle Count: | 100/50, Worst: 100 (Data = 6,0) | |
| [A0] Uncorrectable Sector Count When Read/Write: | 100/50, Worst: 100 | |
| [A1] Number of Valid Spare Blocks: | 100/50, Worst: 100 (Data = 100,0) | |
| [A3] Number of Initial Invalid Blocks: | 100/50, Worst: 100 (Data = 135,0) | |
| [A4] Total Erase Count: | 100/50, Worst: 100 (Data = 479,0) | |
| [A5] Maximum Erase Count: | 100/50, Worst: 100 (Data = 2,0) | |
| [A6] Minimum Erase Count: | 100/50, Worst: 100 | |
| [A7] Average Erase Count: | 100/50, Worst: 100 | |
| [A8] Maximum Erase Count of Spec: | 100/50, Worst: 100 (Data = 1000,0) | |
| [A9] Remaining Life: | 100/50, Worst: 100 (Data = 100,0) | |
| [AF] Program Fail Count In Worst Die: | 100/50, Worst: 100 | |
| [B0] Erase Fail Count In Worst Die: | 100/50, Worst: 100 | |
| [B1] Total Wear Level Count: | 100/50, Worst: 100 | |
| [B2] Runtime Invalid Block Count: | 100/50, Worst: 100 | |
| [B5] Program Fail Count (Total): | 100/50, Worst: 100 | |
| [B6] Erase Fail Count (Total): | 100/50, Worst: 100 | |
| [C0] Power-Off Retract Count: | 100/50, Worst: 100 (Data = 5,0) | |
| [C2] Temperature | 100/50, Worst: 100 (41.0 °C) | |
| [C3] Hardware ECC Recovered: | 100/50, Worst: 100 | |
| [C4] Reallocation Event Count: | 100/50, Worst: 100 | |
| [C5] Current Pending Sector Count: | 100/50, Worst: 100 | |
| [C6] Off-Line Uncorrectable Sector Count: | 100/50, Worst: 100 | |
| [C7] SATA CRC Error Count: | 100/50, Worst: 100 | |
| [E8] Available Reserved Space: | 100/50, Worst: 100 (Data = 100,0) | |
| [F1] Total Host Writes: | 100/50, Worst: 100 (Data = 454,0) | |
| [F2] Total Host Reads: | 100/50, Worst: 100 (Data = 216,0) | |
| [F5] Flash Write Sector Count: | 100/50, Worst: 100 | |
| Drive Remaining Life | 100% | |
| [Device Statistics] | ||
| Lifetime Power-On Resets: | 6 | |
| Power-on Hours: | 0 | |
| Logical Sectors Written: | 29800896 | |
| Logical Sectors Read: | 14185043 | |
| Number of Write Commands: | 276758 | |
| Number of Read Commands: | 140481 | |
| Used Endurance Indicator: | 0% | |
| HL-DT-ST DVDRAM GUE0N |
| [General information] | ||
| Drive Model: | HL-DT-ST DVDRAM GUE0N | |
| Drive Firmware Revision: | T.02 | |
| Firmware Date: | 2015-05-19 09:57:00 | |
| Serial Number: | KYAFCHG0121 | |
| Device Type: | DVD+R DL | |
| [Device Capabilities] | ||
| Drive can read: | CD-R, CD-RW, DVD-R, DVD-RW, DVD+R, DVD+RW, DVD-RAM, DVD+R DL | |
| Drive can write: | CD-RW, DVD-R, DVD-RW, DVD+R, DVD+RW, DVD-RAM, DVD+R DL | |
| Audio |
| Intel Skylake-U/Y PCH - High Definition Audio Controller [C1] |
| Audio Adapter: | Intel Skylake-U/Y PCH - High Definition Audio Controller [C1] | |
| Audio Controller Hardware ID: | PCI\VEN_8086&DEV_9D70&SUBSYS_380817AA&REV_21 | |
| High Definition Audio Codec: | Intel | |
| Audio Codec Hardware ID: | HDAUDIO\FUNC_01&VEN_8086&DEV_2809&SUBSYS_80860101&REV_1000 | |
| [Driver Information] | ||
| Driver Manufacturer: | Microsoft | |
| Driver Description: | High Definition Audio Device | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.264 | |
| Driver Date: | 09-May-2020 | |
| DeviceInstanceId | HDAUDIO\FUNC_01&VEN_8086&DEV_2809&SUBSYS_80860101&REV_1000\4&21F6CD7&0&0201 | |
| Network |
| RealTek Semiconductor RTL8168/8111 PCI-E Gigabit Ethernet NIC |
| [General information] | ||
| Network Card: | RealTek Semiconductor RTL8168/8111 PCI-E Gigabit Ethernet NIC | |
| Vendor Description: | Realtek Ethernet Controller | |
| MAC Address: | 50-7B-9D-C3-CF-1D | |
| [Capabilities] | ||
| Maximum Link Speed: | 1000 Mbps | |
| Transmit Buffer Size: | 193792 Bytes | |
| Receive Buffer Size: | 775168 Bytes | |
| Hardware ID: | PCI\VEN_10EC&DEV_8168&SUBSYS_383717AA&REV_15 | |
| [Driver Information] | ||
| Driver Manufacturer: | Realtek | |
| Driver Description: | Realtek PCIe GbE Family Controller | |
| Driver Provider: | Microsoft | |
| Driver Version: | 9.1.410.2015 | |
| Driver Date: | 10-Apr-2015 | |
| DeviceInstanceId | PCI\VEN_10EC&DEV_8168&SUBSYS_383717AA&REV_15\01000000684CE00000 | |
| Location Paths | PCIROOT(0)#PCI(1C00)#PCI(0000) | |
| Atheros/Qualcomm QCA9377 802.11ac Wireless Network Adapter |
| [General information] | ||
| Network Card: | Atheros/Qualcomm QCA9377 802.11ac Wireless Network Adapter | |
| Vendor Description: | Microsoft | |
| MAC Address: | C8-FF-28-5D-ED-2D | |
| [Capabilities] | ||
| Maximum Link Speed: | 72 Mbps | |
| Transmit Buffer Size: | 9 Bytes | |
| Receive Buffer Size: | 9 Bytes | |
| Hardware ID: | PCI\VEN_168C&DEV_0042&SUBSYS_403517AA&REV_30 | |
| [Driver Information] | ||
| Driver Manufacturer: | Qualcomm Atheros Communications Inc. | |
| Driver Description: | Qualcomm Atheros QCA9377 Wireless Network Adapter | |
| Driver Provider: | Microsoft | |
| Driver Version: | 12.0.0.722 | |
| Driver Date: | 22-Aug-2018 | |
| DeviceInstanceId | PCI\VEN_168C&DEV_0042&SUBSYS_403517AA&REV_30\4&10331FD6&0&00E5 | |
| Location Paths | PCIROOT(0)#PCI(1C05)#PCI(0000) | |
| Ports |
| Serial Ports |
| USB |
| Intel(R) USB 3.0 eXtensible Host Controller - 1.0 (Microsoft) |
| Root Hub |
| [Port1] : Transcend USB Mass Storage Device |
| [Device Information] | ||
| Device Manufacturer: | JetFlash | |
| Product Name: | Mass Storage Device | |
| Serial Number: | 06E8X07J0S1IOGTP | |
| USB Version Supported: | 3.00 (Connected to a USB 2.00 Port) | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | USB Mass Storage Device | |
| Hardware ID: | USB\VID_8564&PID_1000 | |
| [Driver Information] | ||
| Driver Manufacturer: | Compatible USB storage device | |
| Driver Description: | USB Mass Storage Device | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_8564&PID_1000\06E8X07J0S1IOGTP | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(1) | |
| [Port2] : Microsoft USB Wireless Mouse (IntelliPoint) |
| [Device Information] | ||
| Device Manufacturer: | Microsoft | |
| Product Name: | Microsoft® Nano Transceiver v2.0 | |
| Serial Number: | N/A | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | USB Composite Device | |
| Hardware ID: | USB\VID_045E&PID_0745 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standard USB Host Controller) | |
| Driver Description: | USB Composite Device | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.488 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_045E&PID_0745\5&2889B90E&0&2 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(2) | |
| [Port3] : No Device Connected |
| [Port4] : Chicony Electronics Lenovo EasyCamera |
| [Device Information] | ||
| Device Manufacturer: | Chicony Electronics | |
| Product Name: | Chicony Electronics Lenovo EasyCamera | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | USB Composite Device | |
| Hardware ID: | USB\VID_04F2&PID_B50E | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standard USB Host Controller) | |
| Driver Description: | USB Composite Device | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.488 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_04F2&PID_B50E\0001 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(4) | |
| [Port5] : Realtek Semiconductor Realtek USB 2.0 Card Reader |
| [Device Information] | ||
| Device Manufacturer: | Realtek Semiconductor | |
| Product Name: | Realtek Semiconductor Realtek USB 2.0 Card Reader | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | ||
| Hardware ID: | USB\VID_0BDA&PID_0129 | |
| [Port6] : No Device Connected |
| [Port7] : Atheros Communications Qualcomm Atheros QCA9377 Bluetooth 4.1 |
| [Device Information] | ||
| Device Manufacturer: | Atheros Communications Qualcomm Atheros Valkyrie BootROM | |
| Product Name: | Atheros Communications Qualcomm Atheros QCA9377 Bluetooth 4.1 | |
| Serial Number: | - | |
| USB Version Supported: | 2.01 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Generic Bluetooth Adapter | |
| Hardware ID: | USB\VID_0CF3&PID_E360 | |
| [Driver Information] | ||
| Driver Manufacturer: | GenericAdapter | |
| Driver Description: | Generic Bluetooth Adapter | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.488 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_0CF3&PID_E360\5&2889B90E&0&7 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(7) | |
| [Port8] : No Device Connected |
| [Port9] : No Device Connected |
| [Port10] : No Device Connected |
| [Port11] : No Device Connected |
| [Port12] : No Device Connected |
| [Port13] : No Device Connected |
| [Port14] : No Device Connected |
| [Port15] : No Device Connected |
| [Port16] : No Device Connected |
| [Port17] : No Device Connected |
| [Port18] : No Device Connected |
| Smart Battery |
| Battery #0 |
| [General Properties] | ||
| Device Name: | L15M4A01 | |
| Manufacturer Name: | SMP | |
| Serial Number: | 1374 | |
| Unique ID: | 1374SMPL15M4A01 | |
| Chemistry: | Lithium Ion | |
| Designed Capacity: | 32000 mWh | |
| Full Charged Capacity: | 15410 mWh | |
| Wear Level: | 51.8 % | |
| [Current Power Status] | ||
| Power Status: | Charging On AC Power | |
| Current Capacity: | 14240 mWh (92.4 %) | |
| Current Voltage: | 16.395 V | |
| Charge Rate: | 2557 mW | |